C15H7Cl2FO3 — CID 172725983
6,8-dichloro-2-(4-fluorophenyl)-3-hydroxychromen-4-one (PubChem CID 172725983) has the molecular formula C15H7Cl2FO3 and a molecular weight of 325.12 g/mol. Its IUPAC name is 6,8-dichloro-2-(4-fluorophenyl)-3-hydroxychromen-4-one.
| Compound Name | 6,8-dichloro-2-(4-fluorophenyl)-3-hydroxychromen-4-one |
|---|---|
| PubChem CID | 172725983 |
| Molecular Formula | C15H7Cl2FO3 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 6,8-dichloro-2-(4-fluorophenyl)-3-hydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(F)cc2)oc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C15H7Cl2FO3/c16-8-5-10-12(19)13(20)14(21-15(10)11(17)6-8)7-1-3-9(18)4-2-7/h1-6,20H |
| InChIKey | HDQWRQCGDGDCLV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |