C18H22O6S3 — CID 172733350
1,2,3-trimethoxy-4-[(2,3,4-trimethoxyphenyl)trisulfanyl]benzene (PubChem CID 172733350) has the molecular formula C18H22O6S3 and a molecular weight of 430.57 g/mol. Its IUPAC name is 1,2,3-trimethoxy-4-[(2,3,4-trimethoxyphenyl)trisulfanyl]benzene.
| Compound Name | 1,2,3-trimethoxy-4-[(2,3,4-trimethoxyphenyl)trisulfanyl]benzene |
|---|---|
| PubChem CID | 172733350 |
| Molecular Formula | C18H22O6S3 |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1,2,3-trimethoxy-4-[(2,3,4-trimethoxyphenyl)trisulfanyl]benzene |
| SMILES | COc1ccc(SSSc2ccc(OC)c(OC)c2OC)c(OC)c1OC |
| InChI | InChI=1S/C18H22O6S3/c1-19-11-7-9-13(17(23-5)15(11)21-3)25-27-26-14-10-8-12(20-2)16(22-4)18(14)24-6/h7-10H,1-6H3 |
| InChIKey | ICBVZQHOWFFBAA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|