C13H15BFNO4 — CID 172735642
N-[(3R)-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-4-oxopentanamide (PubChem CID 172735642) has the molecular formula C13H15BFNO4 and a molecular weight of 279.08 g/mol. Its IUPAC name is N-[(3R)-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-4-oxopentanamide.
| Compound Name | N-[(3R)-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-4-oxopentanamide |
|---|---|
| PubChem CID | 172735642 |
| Molecular Formula | C13H15BFNO4 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[(3R)-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-4-oxopentanamide |
| SMILES | CC(=O)CCC(=O)N[C@H]1Cc2ccc(F)cc2OB1O |
| InChI | InChI=1S/C13H15BFNO4/c1-8(17)2-5-13(18)16-12-6-9-3-4-10(15)7-11(9)20-14(12)19/h3-4,7,12,19H,2,5-6H2,1H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | IJWKNACYRGPHFR-LBPRGKRZSA-N |
| XLogP | 0.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|