C25H35BF3NO4 — CID 145329357
4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-(11-methyl-8-oxododec-1-en-2-yl)-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide (PubChem CID 145329357) has the molecular formula C25H35BF3NO4 and a molecular weight of 481.36 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-(11-methyl-8-oxododec-1-en-2-yl)-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-(11-methyl-8-oxododec-1-en-2-yl)-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide |
|---|---|
| PubChem CID | 145329357 |
| Molecular Formula | C25H35BF3NO4 |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-(11-methyl-8-oxododec-1-en-2-yl)-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide |
| SMILES | C=C(CCCCCC(=O)CCC(C)C)c1cccc2c1OB(O)[C@@H](NC(=O)CCC(F)(F)F)C2 |
| InChI | InChI=1S/C25H35BF3NO4/c1-17(2)12-13-20(31)10-6-4-5-8-18(3)21-11-7-9-19-16-22(26(33)34-24(19)21)30-23(32)14-15-25(27,28)29/h7,9,11,17,22,33H,3-6,8,10,12-16H2,1-2H3,(H,30,32)/t22-/m0/s1 |
| InChIKey | LKRYQUUWVPFKCJ-QFIPXVFZSA-N |
| XLogP | 5.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|