C19H25BF3NO3 — CID 145329122
5,5,5-trifluoro-N-[(3R)-8-hex-1-en-2-yl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide (PubChem CID 145329122) has the molecular formula C19H25BF3NO3 and a molecular weight of 383.22 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-[(3R)-8-hex-1-en-2-yl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide.
| Compound Name | 5,5,5-trifluoro-N-[(3R)-8-hex-1-en-2-yl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide |
|---|---|
| PubChem CID | 145329122 |
| Molecular Formula | C19H25BF3NO3 |
| Molecular Weight | 383.22 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 5,5,5-trifluoro-N-[(3R)-8-hex-1-en-2-yl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide |
| SMILES | C=C(CCCC)c1cccc2c1OB(O)[C@@H](NC(=O)CCCC(F)(F)F)C2 |
| InChI | InChI=1S/C19H25BF3NO3/c1-3-4-7-13(2)15-9-5-8-14-12-16(20(26)27-18(14)15)24-17(25)10-6-11-19(21,22)23/h5,8-9,16,26H,2-4,6-7,10-12H2,1H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | AAWJZDLFNYYMTQ-INIZCTEOSA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|