C15H17BF3NO3 — CID 145329241
4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide (PubChem CID 145329241) has the molecular formula C15H17BF3NO3 and a molecular weight of 327.11 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide |
|---|---|
| PubChem CID | 145329241 |
| Molecular Formula | C15H17BF3NO3 |
| Molecular Weight | 327.11 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4,4,4-trifluoro-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]butanamide |
| SMILES | C=C(C)c1cccc2c1OB(O)[C@@H](NC(=O)CCC(F)(F)F)C2 |
| InChI | InChI=1S/C15H17BF3NO3/c1-9(2)11-5-3-4-10-8-12(16(22)23-14(10)11)20-13(21)6-7-15(17,18)19/h3-5,12,22H,1,6-8H2,2H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | YMPZKQBOHPKBQH-LBPRGKRZSA-N |
| XLogP | 2.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|