C25H36IN5O5 — CID 172742686
tert-butyl N-[1-[4-(4-amino-2-iodo-5-oxopyrimidin-2-yl)phenyl]ethyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 172742686) has the molecular formula C25H36IN5O5 and a molecular weight of 613.50 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(4-amino-2-iodo-5-oxopyrimidin-2-yl)phenyl]ethyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(4-amino-2-iodo-5-oxopyrimidin-2-yl)phenyl]ethyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 172742686 |
| Molecular Formula | C25H36IN5O5 |
| Molecular Weight | 613.50 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | tert-butyl N-[1-[4-(4-amino-2-iodo-5-oxopyrimidin-2-yl)phenyl]ethyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(c1ccc(C2(I)N=CC(=O)C(N)=N2)cc1)N(CCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H36IN5O5/c1-16(17-9-11-18(12-10-17)25(26)29-15-19(32)20(27)30-25)31(22(34)36-24(5,6)7)14-8-13-28-21(33)35-23(2,3)4/h9-12,15-16H,8,13-14H2,1-7H3,(H2,27,30)(H,28,33) |
| InChIKey | JHRJQNGCAJNFOI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 135.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|