C39H39N5O5S2 — CID 172756576
3-nitro-2-[4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzoyl]-4-[[(2S)-1-phenylsulfanylpropan-2-yl]amino]benzenesulfonamide (PubChem CID 172756576) has the molecular formula C39H39N5O5S2 and a molecular weight of 721.91 g/mol. Its IUPAC name is 3-nitro-2-[4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzoyl]-4-[[(2S)-1-phenylsulfanylpropan-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-nitro-2-[4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzoyl]-4-[[(2S)-1-phenylsulfanylpropan-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 172756576 |
| Molecular Formula | C39H39N5O5S2 |
| Molecular Weight | 721.91 g/mol |
| Exact Mass | 721.24 |
| IUPAC Name | 3-nitro-2-[4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzoyl]-4-[[(2S)-1-phenylsulfanylpropan-2-yl]amino]benzenesulfonamide |
| SMILES | C[C@@H](CSc1ccccc1)Nc1ccc(S(N)(=O)=O)c(C(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccccc4)CC3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C39H39N5O5S2/c1-28(27-50-33-13-6-3-7-14-33)41-35-20-21-36(51(40,48)49)37(38(35)44(46)47)39(45)30-16-18-32(19-17-30)43-24-22-42(23-25-43)26-31-12-8-9-15-34(31)29-10-4-2-5-11-29/h2-21,28,41H,22-27H2,1H3,(H2,40,48,49)/t28-/m0/s1 |
| InChIKey | LCKAMXRSJOQART-NDEPHWFRSA-N |
| XLogP | 7.06 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.91 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|