C48H55N5O6S2 — CID 172832634
4-[(2-methyl-1-phenylsulfanylpropan-2-yl)amino]-3-nitro-2-[4-[4-[(2-phenylphenyl)methyl]-4-(2-piperidin-1-ylethoxy)piperidin-1-yl]benzoyl]benzenesulfonamide (PubChem CID 172832634) has the molecular formula C48H55N5O6S2 and a molecular weight of 862.13 g/mol. Its IUPAC name is 4-[(2-methyl-1-phenylsulfanylpropan-2-yl)amino]-3-nitro-2-[4-[4-[(2-phenylphenyl)methyl]-4-(2-piperidin-1-ylethoxy)piperidin-1-yl]benzoyl]benzenesulfonamide.
| Compound Name | 4-[(2-methyl-1-phenylsulfanylpropan-2-yl)amino]-3-nitro-2-[4-[4-[(2-phenylphenyl)methyl]-4-(2-piperidin-1-ylethoxy)piperidin-1-yl]benzoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 172832634 |
| Molecular Formula | C48H55N5O6S2 |
| Molecular Weight | 862.13 g/mol |
| Exact Mass | 861.36 |
| IUPAC Name | 4-[(2-methyl-1-phenylsulfanylpropan-2-yl)amino]-3-nitro-2-[4-[4-[(2-phenylphenyl)methyl]-4-(2-piperidin-1-ylethoxy)piperidin-1-yl]benzoyl]benzenesulfonamide |
| SMILES | CC(C)(CSc1ccccc1)Nc1ccc(S(N)(=O)=O)c(C(=O)c2ccc(N3CCC(Cc4ccccc4-c4ccccc4)(OCCN4CCCCC4)CC3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C48H55N5O6S2/c1-47(2,35-60-40-17-8-4-9-18-40)50-42-24-25-43(61(49,57)58)44(45(42)53(55)56)46(54)37-20-22-39(23-21-37)52-30-26-48(27-31-52,59-33-32-51-28-12-5-13-29-51)34-38-16-10-11-19-41(38)36-14-6-3-7-15-36/h3-4,6-11,14-25,50H,5,12-13,26-35H2,1-2H3,(H2,49,57,58) |
| InChIKey | VSHJWWJISZGKBP-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.13 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|