C35H39N5O5S2 — CID 11520338
4-[4-methoxy-4-[(2-methylphenyl)methyl]piperidin-1-yl]-N'-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzenecarboximidamide (PubChem CID 11520338) has the molecular formula C35H39N5O5S2 and a molecular weight of 673.86 g/mol. Its IUPAC name is 4-[4-methoxy-4-[(2-methylphenyl)methyl]piperidin-1-yl]-N'-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzenecarboximidamide.
| Compound Name | 4-[4-methoxy-4-[(2-methylphenyl)methyl]piperidin-1-yl]-N'-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 11520338 |
| Molecular Formula | C35H39N5O5S2 |
| Molecular Weight | 673.86 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | 4-[4-methoxy-4-[(2-methylphenyl)methyl]piperidin-1-yl]-N'-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzenecarboximidamide |
| SMILES | COC1(Cc2ccccc2C)CCN(c2ccc(/C(N)=N/S(=O)(=O)c3ccc(NCCSc4ccccc4)c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C35H39N5O5S2/c1-26-8-6-7-9-28(26)25-35(45-2)18-21-39(22-19-35)29-14-12-27(13-15-29)34(36)38-47(43,44)31-16-17-32(33(24-31)40(41)42)37-20-23-46-30-10-4-3-5-11-30/h3-17,24,37H,18-23,25H2,1-2H3,(H2,36,38) |
| InChIKey | PKRFWRWIMHLKKR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.86 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|