C38H45FN6O5S2 — CID 66670478
N'-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[(2-fluorophenyl)methyl]-4-methoxypiperidin-1-yl]benzenecarboximidamide (PubChem CID 66670478) has the molecular formula C38H45FN6O5S2 and a molecular weight of 748.95 g/mol. Its IUPAC name is N'-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[(2-fluorophenyl)methyl]-4-methoxypiperidin-1-yl]benzenecarboximidamide.
| Compound Name | N'-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[(2-fluorophenyl)methyl]-4-methoxypiperidin-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 66670478 |
| Molecular Formula | C38H45FN6O5S2 |
| Molecular Weight | 748.95 g/mol |
| Exact Mass | 748.29 |
| IUPAC Name | N'-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[(2-fluorophenyl)methyl]-4-methoxypiperidin-1-yl]benzenecarboximidamide |
| SMILES | COC1(Cc2ccccc2F)CCN(c2ccc(C(N)=NS(=O)(=O)c3ccc(N[C@H](CCN(C)C)CSc4ccccc4)c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C38H45FN6O5S2/c1-43(2)22-19-30(27-51-32-10-5-4-6-11-32)41-35-18-17-33(25-36(35)45(46)47)52(48,49)42-37(40)28-13-15-31(16-14-28)44-23-20-38(50-3,21-24-44)26-29-9-7-8-12-34(29)39/h4-18,25,30,41H,19-24,26-27H2,1-3H3,(H2,40,42)/t30-/m1/s1 |
| InChIKey | SDXRVSDICLWSKH-SSEXGKCCSA-N |
| XLogP | 6.58 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.95 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|