C37H43N5O5S2 — CID 66670640
4-[4-methoxy-4-[(2-methylphenyl)methyl]piperidin-1-yl]-N'-[4-[(2-methyl-1-phenylsulfanylpropan-2-yl)amino]-3-nitrophenyl]sulfonylbenzenecarboximidamide (PubChem CID 66670640) has the molecular formula C37H43N5O5S2 and a molecular weight of 701.92 g/mol. Its IUPAC name is 4-[4-methoxy-4-[(2-methylphenyl)methyl]piperidin-1-yl]-N'-[4-[(2-methyl-1-phenylsulfanylpropan-2-yl)amino]-3-nitrophenyl]sulfonylbenzenecarboximidamide.
| Compound Name | 4-[4-methoxy-4-[(2-methylphenyl)methyl]piperidin-1-yl]-N'-[4-[(2-methyl-1-phenylsulfanylpropan-2-yl)amino]-3-nitrophenyl]sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 66670640 |
| Molecular Formula | C37H43N5O5S2 |
| Molecular Weight | 701.92 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | 4-[4-methoxy-4-[(2-methylphenyl)methyl]piperidin-1-yl]-N'-[4-[(2-methyl-1-phenylsulfanylpropan-2-yl)amino]-3-nitrophenyl]sulfonylbenzenecarboximidamide |
| SMILES | COC1(Cc2ccccc2C)CCN(c2ccc(C(N)=NS(=O)(=O)c3ccc(NC(C)(C)CSc4ccccc4)c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C37H43N5O5S2/c1-27-10-8-9-11-29(27)25-37(47-4)20-22-41(23-21-37)30-16-14-28(15-17-30)35(38)40-49(45,46)32-18-19-33(34(24-32)42(43)44)39-36(2,3)26-48-31-12-6-5-7-13-31/h5-19,24,39H,20-23,25-26H2,1-4H3,(H2,38,40) |
| InChIKey | JCHKYXCROGDXRJ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.92 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|