C40H38N4O4S2 — CID 59186712
N'-[3-nitro-4-(3-phenylsulfanylpropyl)phenyl]sulfonyl-4-[4-[(2-phenylphenyl)methylidene]piperidin-1-yl]benzenecarboximidamide (PubChem CID 59186712) has the molecular formula C40H38N4O4S2 and a molecular weight of 702.90 g/mol. Its IUPAC name is N'-[3-nitro-4-(3-phenylsulfanylpropyl)phenyl]sulfonyl-4-[4-[(2-phenylphenyl)methylidene]piperidin-1-yl]benzenecarboximidamide.
| Compound Name | N'-[3-nitro-4-(3-phenylsulfanylpropyl)phenyl]sulfonyl-4-[4-[(2-phenylphenyl)methylidene]piperidin-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 59186712 |
| Molecular Formula | C40H38N4O4S2 |
| Molecular Weight | 702.90 g/mol |
| Exact Mass | 702.23 |
| IUPAC Name | N'-[3-nitro-4-(3-phenylsulfanylpropyl)phenyl]sulfonyl-4-[4-[(2-phenylphenyl)methylidene]piperidin-1-yl]benzenecarboximidamide |
| SMILES | N/C(=N/S(=O)(=O)c1ccc(CCCSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(N2CCC(=Cc3ccccc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C40H38N4O4S2/c41-40(42-50(47,48)37-22-19-32(39(29-37)44(45)46)13-9-27-49-36-14-5-2-6-15-36)33-17-20-35(21-18-33)43-25-23-30(24-26-43)28-34-12-7-8-16-38(34)31-10-3-1-4-11-31/h1-8,10-12,14-22,28-29H,9,13,23-27H2,(H2,41,42) |
| InChIKey | DLOOYWAMDVMDQY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.90 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|