C22H21N5O2S — CID 172766225
(5Z)-5-[[3-(1-tert-butyl-2,3-dihydroindol-5-yl)imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 172766225) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is (5Z)-5-[[3-(1-tert-butyl-2,3-dihydroindol-5-yl)imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-(1-tert-butyl-2,3-dihydroindol-5-yl)imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 172766225 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (5Z)-5-[[3-(1-tert-butyl-2,3-dihydroindol-5-yl)imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)(C)N1CCc2cc(-n3cnc4ccc(/C=C5\SC(=O)NC5=O)nc43)ccc21 |
| InChI | InChI=1S/C22H21N5O2S/c1-22(2,3)27-9-8-13-10-15(5-7-17(13)27)26-12-23-16-6-4-14(24-19(16)26)11-18-20(28)25-21(29)30-18/h4-7,10-12H,8-9H2,1-3H3,(H,25,28,29)/b18-11- |
| InChIKey | MISAAOAUNGORIT-WQRHYEAKSA-N |
| XLogP | 3.91 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|