C21H20N6O2S — CID 78108138
5-[[3-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 78108138) has the molecular formula C21H20N6O2S and a molecular weight of 420.50 g/mol. Its IUPAC name is 5-[[3-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 78108138 |
| Molecular Formula | C21H20N6O2S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 5-[[3-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(c2ccc(-n3cnc4ccc(C=C5SC(=O)NC5=O)nc43)cc2)CC1 |
| InChI | InChI=1S/C21H20N6O2S/c1-25-8-10-26(11-9-25)15-3-5-16(6-4-15)27-13-22-17-7-2-14(23-19(17)27)12-18-20(28)24-21(29)30-18/h2-7,12-13H,8-11H2,1H3,(H,24,28,29) |
| InChIKey | BGGFTFLLZPPUBA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|