C24H31BrN2O2 — CID 172807184
N'-(2-bromobenzoyl)-N-[(2R)-2-ethyl-3,3-dimethylbutyl]-3,5-dimethylbenzohydrazide (PubChem CID 172807184) has the molecular formula C24H31BrN2O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is N'-(2-bromobenzoyl)-N-[(2R)-2-ethyl-3,3-dimethylbutyl]-3,5-dimethylbenzohydrazide.
| Compound Name | N'-(2-bromobenzoyl)-N-[(2R)-2-ethyl-3,3-dimethylbutyl]-3,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 172807184 |
| Molecular Formula | C24H31BrN2O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N'-(2-bromobenzoyl)-N-[(2R)-2-ethyl-3,3-dimethylbutyl]-3,5-dimethylbenzohydrazide |
| SMILES | CC[C@@H](CN(NC(=O)c1ccccc1Br)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C24H31BrN2O2/c1-7-19(24(4,5)6)15-27(23(29)18-13-16(2)12-17(3)14-18)26-22(28)20-10-8-9-11-21(20)25/h8-14,19H,7,15H2,1-6H3,(H,26,28)/t19-/m0/s1 |
| InChIKey | RRCIYEBPVBLACU-IBGZPJMESA-N |
| XLogP | 5.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|