About dichloromethane;N,N-dimethylformamide;propan-2-one
dichloromethane;N,N-dimethylformamide;propan-2-one (PubChem CID 172808068) has the molecular formula C7H15Cl2NO2
and a molecular weight of 216.11 g/mol. Its IUPAC name is dichloromethane;N,N-dimethylformamide;propan-2-one.
Molecular Properties
| Compound Name | dichloromethane;N,N-dimethylformamide;propan-2-one |
| PubChem CID | 172808068 |
| Molecular Formula | C7H15Cl2NO2 |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | dichloromethane;N,N-dimethylformamide;propan-2-one |
| SMILES | CC(C)=O.CN(C)C=O.ClCCl |
| InChI | InChI=1S/C3H7NO.C3H6O.CH2Cl2/c1-4(2)3-5;1-3(2)4;2-1-3/h3H,1-2H3;1-2H3;1H2 |
| InChIKey | RUBTUPCOHYAOFE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;N,N-dimethylformamide;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;N,N-dimethylformamide;propan-2-one?
The IUPAC name of dichloromethane;N,N-dimethylformamide;propan-2-one (CID 172808068) is dichloromethane;N,N-dimethylformamide;propan-2-one.
What is the SMILES notation for dichloromethane;N,N-dimethylformamide;propan-2-one?
The canonical SMILES for dichloromethane;N,N-dimethylformamide;propan-2-one is CC(C)=O.CN(C)C=O.ClCCl.
What is the InChIKey of dichloromethane;N,N-dimethylformamide;propan-2-one?
The InChIKey is RUBTUPCOHYAOFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C3H6O.CH2Cl2/c1-4(2)3-5;1-3(2)4;2-1-3/h3H,1-2H3;1-2H3;1H2.
What are the key properties of dichloromethane;N,N-dimethylformamide;propan-2-one?
dichloromethane;N,N-dimethylformamide;propan-2-one has a molecular weight of 216.11 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;N,N-dimethylformamide;propan-2-one is sourced from PubChem (CID 172808068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).