C14H20F4O6S — CID 172848206
2-(5-butoxycarbonyloxy-2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 172848206) has the molecular formula C14H20F4O6S and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-(5-butoxycarbonyloxy-2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(5-butoxycarbonyloxy-2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 172848206 |
| Molecular Formula | C14H20F4O6S |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-(5-butoxycarbonyloxy-2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CCCCOC(=O)OC1CC2CC1CC2C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H20F4O6S/c1-2-3-4-23-12(19)24-11-7-8-5-9(11)6-10(8)13(15,16)14(17,18)25(20,21)22/h8-11H,2-7H2,1H3,(H,20,21,22) |
| InChIKey | GBQMCEDKCVHBTH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|