C13H15F4IO5S — CID 163789189
1,1,2,2-tetrafluoro-2-[5-(2-iodoprop-2-enoyloxymethyl)-2-bicyclo[2.2.1]heptanyl]ethanesulfonic acid (PubChem CID 163789189) has the molecular formula C13H15F4IO5S and a molecular weight of 486.22 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[5-(2-iodoprop-2-enoyloxymethyl)-2-bicyclo[2.2.1]heptanyl]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[5-(2-iodoprop-2-enoyloxymethyl)-2-bicyclo[2.2.1]heptanyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 163789189 |
| Molecular Formula | C13H15F4IO5S |
| Molecular Weight | 486.22 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[5-(2-iodoprop-2-enoyloxymethyl)-2-bicyclo[2.2.1]heptanyl]ethanesulfonic acid |
| SMILES | C=C(I)C(=O)OCC1CC2CC1CC2C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C13H15F4IO5S/c1-6(18)11(19)23-5-9-3-8-2-7(9)4-10(8)12(14,15)13(16,17)24(20,21)22/h7-10H,1-5H2,(H,20,21,22) |
| InChIKey | MVFGIFMIDVDYSM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|