C9H13ClN2S — CID 172851160
4,5,6,7-tetrahydro-2-benzothiophene-1-carboximidamide;hydrochloride (PubChem CID 172851160) has the molecular formula C9H13ClN2S and a molecular weight of 216.74 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-2-benzothiophene-1-carboximidamide;hydrochloride.
| Compound Name | 4,5,6,7-tetrahydro-2-benzothiophene-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 172851160 |
| Molecular Formula | C9H13ClN2S |
| Molecular Weight | 216.74 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4,5,6,7-tetrahydro-2-benzothiophene-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1scc2c1CCCC2 |
| InChI | InChI=1S/C9H12N2S.ClH/c10-9(11)8-7-4-2-1-3-6(7)5-12-8;/h5H,1-4H2,(H3,10,11);1H |
| InChIKey | YBXCYCRIHCLEMS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|