About pentan-2-ylsulfanium chloride
pentan-2-ylsulfanium chloride (PubChem CID 172855201) has the molecular formula C5H13ClS
and a molecular weight of 140.68 g/mol. Its IUPAC name is pentan-2-ylsulfanium chloride.
Molecular Properties
| Compound Name | pentan-2-ylsulfanium chloride |
| PubChem CID | 172855201 |
| Molecular Formula | C5H13ClS |
| Molecular Weight | 140.68 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | pentan-2-ylsulfanium chloride |
| SMILES | CCCC(C)[SH2+].[Cl-] |
| InChI | InChI=1S/C5H12S.ClH/c1-3-4-5(2)6;/h5-6H,3-4H2,1-2H3;1H |
| InChIKey | YPJPLRQRDXOFMQ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.68 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-ylsulfanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-ylsulfanium chloride?
The IUPAC name of pentan-2-ylsulfanium chloride (CID 172855201) is pentan-2-ylsulfanium chloride.
What is the SMILES notation for pentan-2-ylsulfanium chloride?
The canonical SMILES for pentan-2-ylsulfanium chloride is CCCC(C)[SH2+].[Cl-].
What is the InChIKey of pentan-2-ylsulfanium chloride?
The InChIKey is YPJPLRQRDXOFMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12S.ClH/c1-3-4-5(2)6;/h5-6H,3-4H2,1-2H3;1H.
What are the key properties of pentan-2-ylsulfanium chloride?
pentan-2-ylsulfanium chloride has a molecular weight of 140.68 g/mol, XLogP of -1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-ylsulfanium chloride is sourced from PubChem (CID 172855201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).