C18H21F3N2O2 — CID 172858792
2,2-dimethyl-4-[2-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]but-3-ynoic acid (PubChem CID 172858792) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2,2-dimethyl-4-[2-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]but-3-ynoic acid.
| Compound Name | 2,2-dimethyl-4-[2-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]but-3-ynoic acid |
|---|---|
| PubChem CID | 172858792 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2,2-dimethyl-4-[2-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]but-3-ynoic acid |
| SMILES | CC(C)(C#Cc1cccc(C(F)(F)F)c1CN1CCNCC1)C(=O)O |
| InChI | InChI=1S/C18H21F3N2O2/c1-17(2,16(24)25)7-6-13-4-3-5-15(18(19,20)21)14(13)12-23-10-8-22-9-11-23/h3-5,22H,8-12H2,1-2H3,(H,24,25) |
| InChIKey | ZBNRAQKBXFVNOH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|