C3H9Cl4NSi2 — CID 172861548
N,N-bis(dichlorosilyl)propan-1-amine (PubChem CID 172861548) has the molecular formula C3H9Cl4NSi2 and a molecular weight of 257.10 g/mol. Its IUPAC name is N,N-bis(dichlorosilyl)propan-1-amine.
| Compound Name | N,N-bis(dichlorosilyl)propan-1-amine |
|---|---|
| PubChem CID | 172861548 |
| Molecular Formula | C3H9Cl4NSi2 |
| Molecular Weight | 257.10 g/mol |
| Exact Mass | 254.90 |
| IUPAC Name | N,N-bis(dichlorosilyl)propan-1-amine |
| SMILES | CCCN([SiH](Cl)Cl)[SiH](Cl)Cl |
| InChI | InChI=1S/C3H9Cl4NSi2/c1-2-3-8(9(4)5)10(6)7/h9-10H,2-3H2,1H3 |
| InChIKey | ZKOHCSFOCIZASZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|