C6H10O5S2 — CID 172869384
1-(1,1,4,4-tetraoxo-1,4-dithian-2-yl)ethanone (PubChem CID 172869384) has the molecular formula C6H10O5S2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-(1,1,4,4-tetraoxo-1,4-dithian-2-yl)ethanone.
| Compound Name | 1-(1,1,4,4-tetraoxo-1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 172869384 |
| Molecular Formula | C6H10O5S2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 1-(1,1,4,4-tetraoxo-1,4-dithian-2-yl)ethanone |
| SMILES | CC(=O)C1CS(=O)(=O)CCS1(=O)=O |
| InChI | InChI=1S/C6H10O5S2/c1-5(7)6-4-12(8,9)2-3-13(6,10)11/h6H,2-4H2,1H3 |
| InChIKey | LNNYHMDYPCSMQC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |