C25H19BrO5 — CID 172869676
1-[3-bromo-5-[2-(4-methoxyphenyl)ethynyl]phenyl]-2-(3,5-dimethoxyphenyl)ethane-1,2-dione (PubChem CID 172869676) has the molecular formula C25H19BrO5 and a molecular weight of 479.33 g/mol. Its IUPAC name is 1-[3-bromo-5-[2-(4-methoxyphenyl)ethynyl]phenyl]-2-(3,5-dimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[3-bromo-5-[2-(4-methoxyphenyl)ethynyl]phenyl]-2-(3,5-dimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 172869676 |
| Molecular Formula | C25H19BrO5 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 1-[3-bromo-5-[2-(4-methoxyphenyl)ethynyl]phenyl]-2-(3,5-dimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1ccc(C#Cc2cc(Br)cc(C(=O)C(=O)c3cc(OC)cc(OC)c3)c2)cc1 |
| InChI | InChI=1S/C25H19BrO5/c1-29-21-8-6-16(7-9-21)4-5-17-10-18(12-20(26)11-17)24(27)25(28)19-13-22(30-2)15-23(14-19)31-3/h6-15H,1-3H3 |
| InChIKey | CRBNPZFCNOTUID-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|