C44H66O4 — CID 172870087
2-[(3R)-3,7-dimethyloctyl]-3-[2-[3-hydroxy-2-(5-methyl-2-propan-2-ylphenyl)-5-pentylphenoxy]ethoxy]-5-pentylphenol (PubChem CID 172870087) has the molecular formula C44H66O4 and a molecular weight of 659.01 g/mol. Its IUPAC name is 2-[(3R)-3,7-dimethyloctyl]-3-[2-[3-hydroxy-2-(5-methyl-2-propan-2-ylphenyl)-5-pentylphenoxy]ethoxy]-5-pentylphenol.
| Compound Name | 2-[(3R)-3,7-dimethyloctyl]-3-[2-[3-hydroxy-2-(5-methyl-2-propan-2-ylphenyl)-5-pentylphenoxy]ethoxy]-5-pentylphenol |
|---|---|
| PubChem CID | 172870087 |
| Molecular Formula | C44H66O4 |
| Molecular Weight | 659.01 g/mol |
| Exact Mass | 658.50 |
| IUPAC Name | 2-[(3R)-3,7-dimethyloctyl]-3-[2-[3-hydroxy-2-(5-methyl-2-propan-2-ylphenyl)-5-pentylphenoxy]ethoxy]-5-pentylphenol |
| SMILES | CCCCCc1cc(O)c(CC[C@H](C)CCCC(C)C)c(OCCOc2cc(CCCCC)cc(O)c2-c2cc(C)ccc2C(C)C)c1 |
| InChI | InChI=1S/C44H66O4/c1-9-11-13-18-35-27-40(45)38(23-20-33(7)17-15-16-31(3)4)42(29-35)47-24-25-48-43-30-36(19-14-12-10-2)28-41(46)44(43)39-26-34(8)21-22-37(39)32(5)6/h21-22,26-33,45-46H,9-20,23-25H2,1-8H3/t33-/m1/s1 |
| InChIKey | IVYVJYWUXNSHSU-MGBGTMOVSA-N |
| XLogP | 12.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.01 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|