C27H25FO4S — CID 172876481
[3-(4-fluoro-2-methoxyphenyl)-4-(4-hydroxyphenyl)-2H-thiochromen-7-yl] 2,2-dimethylpropanoate (PubChem CID 172876481) has the molecular formula C27H25FO4S and a molecular weight of 464.56 g/mol. Its IUPAC name is [3-(4-fluoro-2-methoxyphenyl)-4-(4-hydroxyphenyl)-2H-thiochromen-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-(4-fluoro-2-methoxyphenyl)-4-(4-hydroxyphenyl)-2H-thiochromen-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 172876481 |
| Molecular Formula | C27H25FO4S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [3-(4-fluoro-2-methoxyphenyl)-4-(4-hydroxyphenyl)-2H-thiochromen-7-yl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(F)ccc1C1=C(c2ccc(O)cc2)c2ccc(OC(=O)C(C)(C)C)cc2SC1 |
| InChI | InChI=1S/C27H25FO4S/c1-27(2,3)26(30)32-19-10-12-21-24(14-19)33-15-22(20-11-7-17(28)13-23(20)31-4)25(21)16-5-8-18(29)9-6-16/h5-14,29H,15H2,1-4H3 |
| InChIKey | KHCZQDZCHVVXDO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|