C14H10FNOS — CID 172877195
2-(4-fluoro-3-methylphenyl)-1,2-benzothiazol-3-one (PubChem CID 172877195) has the molecular formula C14H10FNOS and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-1,2-benzothiazol-3-one.
| Compound Name | 2-(4-fluoro-3-methylphenyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 172877195 |
| Molecular Formula | C14H10FNOS |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-1,2-benzothiazol-3-one |
| SMILES | Cc1cc(-n2sc3ccccc3c2=O)ccc1F |
| InChI | InChI=1S/C14H10FNOS/c1-9-8-10(6-7-12(9)15)16-14(17)11-4-2-3-5-13(11)18-16/h2-8H,1H3 |
| InChIKey | WCAWTAWTFITQED-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |