C14H23CuN6O4- — CID 172878384
copper (2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1,2-dihydroimidazol-3-id-4-yl)propanoyl]amino]hexanoate (PubChem CID 172878384) has the molecular formula C14H23CuN6O4- and a molecular weight of 402.92 g/mol. Its IUPAC name is copper (2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1,2-dihydroimidazol-3-id-4-yl)propanoyl]amino]hexanoate.
| Compound Name | copper (2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1,2-dihydroimidazol-3-id-4-yl)propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 172878384 |
| Molecular Formula | C14H23CuN6O4- |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | copper (2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1,2-dihydroimidazol-3-id-4-yl)propanoyl]amino]hexanoate |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CC1=CNC[N-]1)[N-]C(=O)CN)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/C14H25N6O4.Cu/c15-4-2-1-3-10(14(23)24)20-13(22)11(19-12(21)6-16)5-9-7-17-8-18-9;/h7,10-11,17H,1-6,8,15-16H2,(H3,19,20,21,22,23,24);/q-1;+2/p-2/t10-,11-;/m0./s1 |
| InChIKey | PSXACKMIRDXEEH-ACMTZBLWSA-L |
| XLogP | -2.26 |
| TPSA | 178.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|