C15H24CuN6O4 — CID 10251304
copper 6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(5-methylimidazol-3-id-4-yl)propanoyl]amino]hexanoate (PubChem CID 10251304) has the molecular formula C15H24CuN6O4 and a molecular weight of 415.94 g/mol. Its IUPAC name is copper 6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(5-methylimidazol-3-id-4-yl)propanoyl]amino]hexanoate.
| Compound Name | copper 6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(5-methylimidazol-3-id-4-yl)propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 10251304 |
| Molecular Formula | C15H24CuN6O4 |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | copper 6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(5-methylimidazol-3-id-4-yl)propanoyl]amino]hexanoate |
| SMILES | Cc1nc[n-]c1CC(NC(=O)CN)C(=O)NC(CCCCN)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/C15H26N6O4.Cu/c1-9-11(19-8-18-9)6-12(20-13(22)7-17)14(23)21-10(15(24)25)4-2-3-5-16;/h8,10,12H,2-7,16-17H2,1H3,(H4,18,19,20,21,22,23,24,25);/q;+2/p-2 |
| InChIKey | APTMOMDREWRONR-UHFFFAOYSA-L |
| XLogP | -3.31 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|