C13H14BrCl2NO3 — CID 172919351
[(2S,4Z)-1-bromo-4-methoxyimino-3-methylbutan-2-yl] 2,4-dichlorobenzoate (PubChem CID 172919351) has the molecular formula C13H14BrCl2NO3 and a molecular weight of 383.07 g/mol. Its IUPAC name is [(2S,4Z)-1-bromo-4-methoxyimino-3-methylbutan-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [(2S,4Z)-1-bromo-4-methoxyimino-3-methylbutan-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 172919351 |
| Molecular Formula | C13H14BrCl2NO3 |
| Molecular Weight | 383.07 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | [(2S,4Z)-1-bromo-4-methoxyimino-3-methylbutan-2-yl] 2,4-dichlorobenzoate |
| SMILES | CO/N=C\C(C)[C@@H](CBr)OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14BrCl2NO3/c1-8(7-17-19-2)12(6-14)20-13(18)10-4-3-9(15)5-11(10)16/h3-5,7-8,12H,6H2,1-2H3/b17-7-/t8?,12-/m1/s1 |
| InChIKey | HJQGLBNDDABASY-QUEHLHMSSA-N |
| XLogP | 4.18 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.07 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|