About azane;2-hydroxy-N'-(methylamino)butanimidamide
azane;2-hydroxy-N'-(methylamino)butanimidamide (PubChem CID 172928382) has the molecular formula C5H16N4O
and a molecular weight of 148.21 g/mol. Its IUPAC name is azane;2-hydroxy-N'-(methylamino)butanimidamide.
Molecular Properties
| Compound Name | azane;2-hydroxy-N'-(methylamino)butanimidamide |
| PubChem CID | 172928382 |
| Molecular Formula | C5H16N4O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | azane;2-hydroxy-N'-(methylamino)butanimidamide |
| SMILES | CCC(O)/C(N)=N/NC.N |
| InChI | InChI=1S/C5H13N3O.H3N/c1-3-4(9)5(6)8-7-2;/h4,7,9H,3H2,1-2H3,(H2,6,8);1H3 |
| InChIKey | RMNWRXOEKFMMAL-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;2-hydroxy-N'-(methylamino)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-hydroxy-N'-(methylamino)butanimidamide?
The IUPAC name of azane;2-hydroxy-N'-(methylamino)butanimidamide (CID 172928382) is azane;2-hydroxy-N'-(methylamino)butanimidamide.
What is the SMILES notation for azane;2-hydroxy-N'-(methylamino)butanimidamide?
The canonical SMILES for azane;2-hydroxy-N'-(methylamino)butanimidamide is CCC(O)/C(N)=N/NC.N.
What is the InChIKey of azane;2-hydroxy-N'-(methylamino)butanimidamide?
The InChIKey is RMNWRXOEKFMMAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O.H3N/c1-3-4(9)5(6)8-7-2;/h4,7,9H,3H2,1-2H3,(H2,6,8);1H3.
What are the key properties of azane;2-hydroxy-N'-(methylamino)butanimidamide?
azane;2-hydroxy-N'-(methylamino)butanimidamide has a molecular weight of 148.21 g/mol, XLogP of -0.59, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-hydroxy-N'-(methylamino)butanimidamide is sourced from PubChem (CID 172928382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).