C32H30N5NaO6S2 — CID 172935262
sodium (3E)-7-anilino-3-[[4-[(4-ethylsulfonylphenyl)diazenyl]-2-methoxy-5-methylphenyl]hydrazinylidene]-4H-naphthalene-2-sulfonate (PubChem CID 172935262) has the molecular formula C32H30N5NaO6S2 and a molecular weight of 667.75 g/mol. Its IUPAC name is sodium (3E)-7-anilino-3-[[4-[(4-ethylsulfonylphenyl)diazenyl]-2-methoxy-5-methylphenyl]hydrazinylidene]-4H-naphthalene-2-sulfonate.
| Compound Name | sodium (3E)-7-anilino-3-[[4-[(4-ethylsulfonylphenyl)diazenyl]-2-methoxy-5-methylphenyl]hydrazinylidene]-4H-naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 172935262 |
| Molecular Formula | C32H30N5NaO6S2 |
| Molecular Weight | 667.75 g/mol |
| Exact Mass | 667.15 |
| IUPAC Name | sodium (3E)-7-anilino-3-[[4-[(4-ethylsulfonylphenyl)diazenyl]-2-methoxy-5-methylphenyl]hydrazinylidene]-4H-naphthalene-2-sulfonate |
| SMILES | CCS(=O)(=O)c1ccc(/N=N/c2cc(OC)c(N/N=C3\Cc4ccc(Nc5ccccc5)cc4C=C3S(=O)(=O)[O-])cc2C)cc1.[Na+] |
| InChI | InChI=1S/C32H31N5O6S2.Na/c1-4-44(38,39)27-14-12-25(13-15-27)34-35-28-20-31(43-3)29(16-21(28)2)36-37-30-18-22-10-11-26(33-24-8-6-5-7-9-24)17-23(22)19-32(30)45(40,41)42;/h5-17,19-20,33,36H,4,18H2,1-3H3,(H,40,41,42);/q;+1/p-1/b35-34+,37-30+; |
| InChIKey | BBUQDDCENZGAKS-BIHAPRSBSA-M |
| XLogP | 3.87 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.75 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|