C27H36N6O5S2 — CID 172935876
(1E)-3-[5-[2-(dimethylamino)ethylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-1-[4-(3-methoxypropylsulfonyl)phenyl]-1-morpholin-4-yliminopropan-2-one (PubChem CID 172935876) has the molecular formula C27H36N6O5S2 and a molecular weight of 588.76 g/mol. Its IUPAC name is (1E)-3-[5-[2-(dimethylamino)ethylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-1-[4-(3-methoxypropylsulfonyl)phenyl]-1-morpholin-4-yliminopropan-2-one.
| Compound Name | (1E)-3-[5-[2-(dimethylamino)ethylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-1-[4-(3-methoxypropylsulfonyl)phenyl]-1-morpholin-4-yliminopropan-2-one |
|---|---|
| PubChem CID | 172935876 |
| Molecular Formula | C27H36N6O5S2 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | (1E)-3-[5-[2-(dimethylamino)ethylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-1-[4-(3-methoxypropylsulfonyl)phenyl]-1-morpholin-4-yliminopropan-2-one |
| SMILES | COCCCS(=O)(=O)c1ccc(/C(=N\N2CCOCC2)C(=O)Cc2nc3ccc(NCCN(C)C)nc3s2)cc1 |
| InChI | InChI=1S/C27H36N6O5S2/c1-32(2)12-11-28-24-10-9-22-27(30-24)39-25(29-22)19-23(34)26(31-33-13-16-38-17-14-33)20-5-7-21(8-6-20)40(35,36)18-4-15-37-3/h5-10H,4,11-19H2,1-3H3,(H,28,30)/b31-26+ |
| InChIKey | PDOHCEKREIUIDF-GKPLWNPISA-N |
| XLogP | 2.32 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|