C17H18FN3O4S2 — CID 172945001
(1E)-3-(5-fluoro-1,3-thiazol-2-yl)-1-(4-methylsulfonylphenyl)-1-morpholin-4-yliminopropan-2-one (PubChem CID 172945001) has the molecular formula C17H18FN3O4S2 and a molecular weight of 411.48 g/mol. Its IUPAC name is (1E)-3-(5-fluoro-1,3-thiazol-2-yl)-1-(4-methylsulfonylphenyl)-1-morpholin-4-yliminopropan-2-one.
| Compound Name | (1E)-3-(5-fluoro-1,3-thiazol-2-yl)-1-(4-methylsulfonylphenyl)-1-morpholin-4-yliminopropan-2-one |
|---|---|
| PubChem CID | 172945001 |
| Molecular Formula | C17H18FN3O4S2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (1E)-3-(5-fluoro-1,3-thiazol-2-yl)-1-(4-methylsulfonylphenyl)-1-morpholin-4-yliminopropan-2-one |
| SMILES | CS(=O)(=O)c1ccc(/C(=N\N2CCOCC2)C(=O)Cc2ncc(F)s2)cc1 |
| InChI | InChI=1S/C17H18FN3O4S2/c1-27(23,24)13-4-2-12(3-5-13)17(20-21-6-8-25-9-7-21)14(22)10-16-19-11-15(18)26-16/h2-5,11H,6-10H2,1H3/b20-17+ |
| InChIKey | XENHSVBZGYBQHI-LVZFUZTISA-N |
| XLogP | 1.53 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|