C21H27N5O4S2 — CID 24999886
(2Z)-2-(4-methylsulfonylphenyl)-N-[5-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]-2-pyrrolidin-1-yliminoacetamide (PubChem CID 24999886) has the molecular formula C21H27N5O4S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is (2Z)-2-(4-methylsulfonylphenyl)-N-[5-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]-2-pyrrolidin-1-yliminoacetamide.
| Compound Name | (2Z)-2-(4-methylsulfonylphenyl)-N-[5-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]-2-pyrrolidin-1-yliminoacetamide |
|---|---|
| PubChem CID | 24999886 |
| Molecular Formula | C21H27N5O4S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (2Z)-2-(4-methylsulfonylphenyl)-N-[5-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]-2-pyrrolidin-1-yliminoacetamide |
| SMILES | CS(=O)(=O)c1ccc(/C(=N/N2CCCC2)C(=O)Nc2ncc(CN3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C21H27N5O4S2/c1-32(28,29)18-6-4-16(5-7-18)19(24-26-8-2-3-9-26)20(27)23-21-22-14-17(31-21)15-25-10-12-30-13-11-25/h4-7,14H,2-3,8-13,15H2,1H3,(H,22,23,27)/b24-19- |
| InChIKey | CGMACZKXPKVSDR-CLCOLTQESA-N |
| XLogP | 1.82 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|