C16H18N4O3S2 — CID 172946792
(1E)-1-(4-methylsulfonylphenyl)-1-pyrrolidin-1-ylimino-3-(1,2,4-thiadiazol-5-yl)propan-2-one (PubChem CID 172946792) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (1E)-1-(4-methylsulfonylphenyl)-1-pyrrolidin-1-ylimino-3-(1,2,4-thiadiazol-5-yl)propan-2-one.
| Compound Name | (1E)-1-(4-methylsulfonylphenyl)-1-pyrrolidin-1-ylimino-3-(1,2,4-thiadiazol-5-yl)propan-2-one |
|---|---|
| PubChem CID | 172946792 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (1E)-1-(4-methylsulfonylphenyl)-1-pyrrolidin-1-ylimino-3-(1,2,4-thiadiazol-5-yl)propan-2-one |
| SMILES | CS(=O)(=O)c1ccc(/C(=N\N2CCCC2)C(=O)Cc2ncns2)cc1 |
| InChI | InChI=1S/C16H18N4O3S2/c1-25(22,23)13-6-4-12(5-7-13)16(19-20-8-2-3-9-20)14(21)10-15-17-11-18-24-15/h4-7,11H,2-3,8-10H2,1H3/b19-16+ |
| InChIKey | NWRNPWDUTBDWIY-KNTRCKAVSA-N |
| XLogP | 1.55 |
| TPSA | 92.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|