C26H37N5O4S2 — CID 172984641
(1E)-1-[4-(3-methoxypropylsulfonyl)phenyl]-3-[5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]-1-pyrrolidin-1-yliminopropan-2-one (PubChem CID 172984641) has the molecular formula C26H37N5O4S2 and a molecular weight of 547.75 g/mol. Its IUPAC name is (1E)-1-[4-(3-methoxypropylsulfonyl)phenyl]-3-[5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]-1-pyrrolidin-1-yliminopropan-2-one.
| Compound Name | (1E)-1-[4-(3-methoxypropylsulfonyl)phenyl]-3-[5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]-1-pyrrolidin-1-yliminopropan-2-one |
|---|---|
| PubChem CID | 172984641 |
| Molecular Formula | C26H37N5O4S2 |
| Molecular Weight | 547.75 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | (1E)-1-[4-(3-methoxypropylsulfonyl)phenyl]-3-[5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]-1-pyrrolidin-1-yliminopropan-2-one |
| SMILES | COCCCS(=O)(=O)c1ccc(/C(=N\N2CCCC2)C(=O)Cc2ncc(CN3CCN(C)CC3)s2)cc1 |
| InChI | InChI=1S/C26H37N5O4S2/c1-29-12-14-30(15-13-29)20-22-19-27-25(36-22)18-24(32)26(28-31-10-3-4-11-31)21-6-8-23(9-7-21)37(33,34)17-5-16-35-2/h6-9,19H,3-5,10-18,20H2,1-2H3/b28-26+ |
| InChIKey | OQTSCFBKALONEV-BYCLXTJYSA-N |
| XLogP | 2.31 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|