C28H39N7O13 — CID 172944542
1-(2-aminoethyl)pyrrole-2,5-dione;(2,5-dioxopyrrolidin-1-yl) 2-[(Z)-1-ethoxyethylideneamino]oxyacetate;ethyl (1Z)-N-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]ethanimidate (PubChem CID 172944542) has the molecular formula C28H39N7O13 and a molecular weight of 681.66 g/mol. Its IUPAC name is 1-(2-aminoethyl)pyrrole-2,5-dione;(2,5-dioxopyrrolidin-1-yl) 2-[(Z)-1-ethoxyethylideneamino]oxyacetate;ethyl (1Z)-N-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]ethanimidate.
| Compound Name | 1-(2-aminoethyl)pyrrole-2,5-dione;(2,5-dioxopyrrolidin-1-yl) 2-[(Z)-1-ethoxyethylideneamino]oxyacetate;ethyl (1Z)-N-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]ethanimidate |
|---|---|
| PubChem CID | 172944542 |
| Molecular Formula | C28H39N7O13 |
| Molecular Weight | 681.66 g/mol |
| Exact Mass | 681.26 |
| IUPAC Name | 1-(2-aminoethyl)pyrrole-2,5-dione;(2,5-dioxopyrrolidin-1-yl) 2-[(Z)-1-ethoxyethylideneamino]oxyacetate;ethyl (1Z)-N-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]ethanimidate |
| SMILES | CCO/C(C)=N\OCC(=O)NCCN1C(=O)C=CC1=O.CCO/C(C)=N\OCC(=O)ON1C(=O)CCC1=O.NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17N3O5.C10H14N2O6.C6H8N2O2/c1-3-19-9(2)14-20-8-10(16)13-6-7-15-11(17)4-5-12(15)18;1-3-16-7(2)11-17-6-10(15)18-12-8(13)4-5-9(12)14;7-3-4-8-5(9)1-2-6(8)10/h4-5H,3,6-8H2,1-2H3,(H,13,16);3-6H2,1-2H3;1-2H,3-4,7H2/b14-9-;11-7-; |
| InChIKey | GEUHILKVBTUWGP-QNHCKWNSSA-N |
| XLogP | -1.74 |
| TPSA | 255.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.66 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|