C7H13N5O — CID 172996519
3-(methylamino)-N,2,3-tris(methylimino)propanamide (PubChem CID 172996519) has the molecular formula C7H13N5O and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-(methylamino)-N,2,3-tris(methylimino)propanamide.
| Compound Name | 3-(methylamino)-N,2,3-tris(methylimino)propanamide |
|---|---|
| PubChem CID | 172996519 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 3-(methylamino)-N,2,3-tris(methylimino)propanamide |
| SMILES | C/N=C(NC)/C(=N/C)C(=O)/N=N/C |
| InChI | InChI=1S/C7H13N5O/c1-8-5(6(9-2)10-3)7(13)12-11-4/h1-4H3,(H,9,10)/b8-5-,12-11+ |
| InChIKey | IOBMRGCPEWJUQB-OUICKUJRSA-N |
| XLogP | -0.09 |
| TPSA | 78.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|