About 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide
2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide (PubChem CID 144893888) has the molecular formula C5H11N3O2
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide.
Molecular Properties
| Compound Name | 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide |
| PubChem CID | 144893888 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide |
| SMILES | C/N=C(\NO)C(=O)N(C)C |
| InChI | InChI=1S/C5H11N3O2/c1-6-4(7-10)5(9)8(2)3/h10H,1-3H3,(H,6,7) |
| InChIKey | XKUPAGXTXCUBLW-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide?
The IUPAC name of 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide (CID 144893888) is 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide.
What is the SMILES notation for 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide?
The canonical SMILES for 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide is C/N=C(\NO)C(=O)N(C)C.
What is the InChIKey of 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide?
The InChIKey is XKUPAGXTXCUBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O2/c1-6-4(7-10)5(9)8(2)3/h10H,1-3H3,(H,6,7).
What are the key properties of 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide?
2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide has a molecular weight of 145.16 g/mol, XLogP of -0.92, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxyamino)-N,N-dimethyl-2-methyliminoacetamide is sourced from PubChem (CID 144893888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).