C8H12N2O2S — CID 172999689
N-tert-butyl-5-oxo-2H-1,2-thiazole-3-carboxamide (PubChem CID 172999689) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-tert-butyl-5-oxo-2H-1,2-thiazole-3-carboxamide.
| Compound Name | N-tert-butyl-5-oxo-2H-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 172999689 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-tert-butyl-5-oxo-2H-1,2-thiazole-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cc(=O)s[nH]1 |
| InChI | InChI=1S/C8H12N2O2S/c1-8(2,3)9-7(12)5-4-6(11)13-10-5/h4,10H,1-3H3,(H,9,12) |
| InChIKey | GKXGWKDNRDYLNJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |