C8H22N2O2Si — CID 173004236
2-diethoxysilyl-1-N'-ethylethane-1,1-diamine (PubChem CID 173004236) has the molecular formula C8H22N2O2Si and a molecular weight of 206.36 g/mol. Its IUPAC name is 2-diethoxysilyl-1-N'-ethylethane-1,1-diamine.
| Compound Name | 2-diethoxysilyl-1-N'-ethylethane-1,1-diamine |
|---|---|
| PubChem CID | 173004236 |
| Molecular Formula | C8H22N2O2Si |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-diethoxysilyl-1-N'-ethylethane-1,1-diamine |
| SMILES | CCNC(N)C[SiH](OCC)OCC |
| InChI | InChI=1S/C8H22N2O2Si/c1-4-10-8(9)7-13(11-5-2)12-6-3/h8,10,13H,4-7,9H2,1-3H3 |
| InChIKey | CFWYWDIZBVOLTE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|