C12H30N2O3Si — CID 173450427
1-N'-cyclopropylpropane-1,1-diamine;triethoxysilane (PubChem CID 173450427) has the molecular formula C12H30N2O3Si and a molecular weight of 278.47 g/mol. Its IUPAC name is 1-N'-cyclopropylpropane-1,1-diamine;triethoxysilane.
| Compound Name | 1-N'-cyclopropylpropane-1,1-diamine;triethoxysilane |
|---|---|
| PubChem CID | 173450427 |
| Molecular Formula | C12H30N2O3Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-N'-cyclopropylpropane-1,1-diamine;triethoxysilane |
| SMILES | CCC(N)NC1CC1.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H14N2.C6H16O3Si/c1-2-6(7)8-5-3-4-5;1-4-7-10(8-5-2)9-6-3/h5-6,8H,2-4,7H2,1H3;10H,4-6H2,1-3H3 |
| InChIKey | DUEHNOGRNDAJOQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|