C19H36O6Si — CID 173004431
3-(4-tert-butyl-1-dimethylsilyloxycyclohexyl)-2-hydroxy-2-propan-2-ylbutanedioic acid (PubChem CID 173004431) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is 3-(4-tert-butyl-1-dimethylsilyloxycyclohexyl)-2-hydroxy-2-propan-2-ylbutanedioic acid.
| Compound Name | 3-(4-tert-butyl-1-dimethylsilyloxycyclohexyl)-2-hydroxy-2-propan-2-ylbutanedioic acid |
|---|---|
| PubChem CID | 173004431 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 3-(4-tert-butyl-1-dimethylsilyloxycyclohexyl)-2-hydroxy-2-propan-2-ylbutanedioic acid |
| SMILES | CC(C)C(O)(C(=O)O)C(C(=O)O)C1(O[SiH](C)C)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H36O6Si/c1-12(2)19(24,16(22)23)14(15(20)21)18(25-26(6)7)10-8-13(9-11-18)17(3,4)5/h12-14,24,26H,8-11H2,1-7H3,(H,20,21)(H,22,23) |
| InChIKey | WPYWZWATXDJONE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|