About CID 173015066
CID 173015066 (PubChem CID 173015066) has the molecular formula C7H17Si
and a molecular weight of 129.30 g/mol.
Molecular Properties
| Compound Name | CID 173015066 |
| PubChem CID | 173015066 |
| Molecular Formula | C7H17Si |
| Molecular Weight | 129.30 g/mol |
| Exact Mass | 129.11 |
| IUPAC Name | — |
| SMILES | CCCC([SiH2])CCC |
| InChI | InChI=1S/C7H17Si/c1-3-5-7(8)6-4-2/h7H,3-6,8H2,1-2H3 |
| InChIKey | BKFGCIXMTGUWSD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173015066 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173015066?
The IUPAC name of CID 173015066 (CID 173015066) is not available.
What is the SMILES notation for CID 173015066?
The canonical SMILES for CID 173015066 is CCCC([SiH2])CCC.
What is the InChIKey of CID 173015066?
The InChIKey is BKFGCIXMTGUWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17Si/c1-3-5-7(8)6-4-2/h7H,3-6,8H2,1-2H3.
What are the key properties of CID 173015066?
CID 173015066 has a molecular weight of 129.30 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173015066 is sourced from PubChem (CID 173015066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).