About 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide
3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide (PubChem CID 173034939) has the molecular formula C10H20BrNO3
and a molecular weight of 282.18 g/mol. Its IUPAC name is 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide.
Molecular Properties
| Compound Name | 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide |
| PubChem CID | 173034939 |
| Molecular Formula | C10H20BrNO3 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide |
| SMILES | Br.C=CC(=O)OCCCN(CC)CCO |
| InChI | InChI=1S/C10H19NO3.BrH/c1-3-10(13)14-9-5-6-11(4-2)7-8-12;/h3,12H,1,4-9H2,2H3;1H |
| InChIKey | GUMLEWDKFKJNHY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide?
The IUPAC name of 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide (CID 173034939) is 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide.
What is the SMILES notation for 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide?
The canonical SMILES for 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide is Br.C=CC(=O)OCCCN(CC)CCO.
What is the InChIKey of 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide?
The InChIKey is GUMLEWDKFKJNHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.BrH/c1-3-10(13)14-9-5-6-11(4-2)7-8-12;/h3,12H,1,4-9H2,2H3;1H.
What are the key properties of 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide?
3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide has a molecular weight of 282.18 g/mol, XLogP of 1.00, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(2-hydroxyethyl)amino]propyl prop-2-enoate;hydrobromide is sourced from PubChem (CID 173034939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).