C14H14Cl2 — CID 173052194
1,5-dichloro-6-(1-phenylethyl)cyclohexa-1,3-diene (PubChem CID 173052194) has the molecular formula C14H14Cl2 and a molecular weight of 253.17 g/mol. Its IUPAC name is 1,5-dichloro-6-(1-phenylethyl)cyclohexa-1,3-diene.
| Compound Name | 1,5-dichloro-6-(1-phenylethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173052194 |
| Molecular Formula | C14H14Cl2 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1,5-dichloro-6-(1-phenylethyl)cyclohexa-1,3-diene |
| SMILES | CC(c1ccccc1)C1C(Cl)=CC=CC1Cl |
| InChI | InChI=1S/C14H14Cl2/c1-10(11-6-3-2-4-7-11)14-12(15)8-5-9-13(14)16/h2-10,12,14H,1H3 |
| InChIKey | FODFPOUOWQCGIH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|