About pyrido[2,3-d]pyrimidin-3-ium
pyrido[2,3-d]pyrimidin-3-ium (PubChem CID 173052686) has the molecular formula C7H6N3+
and a molecular weight of 132.15 g/mol. Its IUPAC name is pyrido[2,3-d]pyrimidin-3-ium.
Molecular Properties
| Compound Name | pyrido[2,3-d]pyrimidin-3-ium |
| PubChem CID | 173052686 |
| Molecular Formula | C7H6N3+ |
| Molecular Weight | 132.15 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | pyrido[2,3-d]pyrimidin-3-ium |
| SMILES | c1cnc2nc[nH+]cc2c1 |
| InChI | InChI=1S/C7H5N3/c1-2-6-4-8-5-10-7(6)9-3-1/h1-5H/p+1 |
| InChIKey | UDJFFSGCRRMVFH-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.15 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrido[2,3-d]pyrimidin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,3-d]pyrimidin-3-ium?
The IUPAC name of pyrido[2,3-d]pyrimidin-3-ium (CID 173052686) is pyrido[2,3-d]pyrimidin-3-ium.
What is the SMILES notation for pyrido[2,3-d]pyrimidin-3-ium?
The canonical SMILES for pyrido[2,3-d]pyrimidin-3-ium is c1cnc2nc[nH+]cc2c1.
What is the InChIKey of pyrido[2,3-d]pyrimidin-3-ium?
The InChIKey is UDJFFSGCRRMVFH-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H5N3/c1-2-6-4-8-5-10-7(6)9-3-1/h1-5H/p+1.
What are the key properties of pyrido[2,3-d]pyrimidin-3-ium?
pyrido[2,3-d]pyrimidin-3-ium has a molecular weight of 132.15 g/mol, XLogP of 0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-d]pyrimidin-3-ium is sourced from PubChem (CID 173052686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).