About cyclohexene;1,8-naphthyridine
cyclohexene;1,8-naphthyridine (PubChem CID 174681828) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is cyclohexene;1,8-naphthyridine.
Molecular Properties
| Compound Name | cyclohexene;1,8-naphthyridine |
| PubChem CID | 174681828 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | cyclohexene;1,8-naphthyridine |
| SMILES | C1=CCCCC1.c1cnc2ncccc2c1 |
| InChI | InChI=1S/C8H6N2.C6H10/c1-3-7-4-2-6-10-8(7)9-5-1;1-2-4-6-5-3-1/h1-6H;1-2H,3-6H2 |
| InChIKey | KDYQQFLMQHGUNA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexene;1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene;1,8-naphthyridine?
The IUPAC name of cyclohexene;1,8-naphthyridine (CID 174681828) is cyclohexene;1,8-naphthyridine.
What is the SMILES notation for cyclohexene;1,8-naphthyridine?
The canonical SMILES for cyclohexene;1,8-naphthyridine is C1=CCCCC1.c1cnc2ncccc2c1.
What is the InChIKey of cyclohexene;1,8-naphthyridine?
The InChIKey is KDYQQFLMQHGUNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C6H10/c1-3-7-4-2-6-10-8(7)9-5-1;1-2-4-6-5-3-1/h1-6H;1-2H,3-6H2.
What are the key properties of cyclohexene;1,8-naphthyridine?
cyclohexene;1,8-naphthyridine has a molecular weight of 212.30 g/mol, XLogP of 3.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene;1,8-naphthyridine is sourced from PubChem (CID 174681828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).